Products 908856-67-7
CAS 908856-67-7 appears in our catalog under these names: 5-Cyclopentyl-1,2-oxazole-3-carboxylic acid, 5-Cyclopentylisoxazole-3-carboxylic acid, 98%, 5-Cyclopentyl-1,2-oxazole-3-carboxylic acid, 98%. Offered by: Biosynth, Ambeed, BLDpharm, Chemat. Available pack sizes: 0,5g, 50mg, 250mg, 1g, 5g, 100mg.
5-cyclopentyl-1,2-oxazole-3-carboxylic acid (CAS 908856-67-7) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 5-cyclopentyl-1,2-oxazole-3-carboxylic acid. InChIKey: KGTFQUOPSNNCTE-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 5-cyclopentyl-1,2-oxazole-3-carboxylic acid |
| InChIKey | KGTFQUOPSNNCTE-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)C2=CC(=NO2)C(=O)O |
Computed by PubChem (NCBI)