CAS 90921-10-1 is the registry number for 4-oxo-8-Chromancarboxylic Acid. Offered by: TRC. Available pack sizes: 2,5g.
4-oxo-2,3-dihydrochromene-8-carboxylic acid (CAS 90921-10-1) is a chemical compound with the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. IUPAC name: 4-oxo-2,3-dihydrochromene-8-carboxylic acid. InChIKey: XWMBBUVUBABHDZ-UHFFFAOYSA-N.
| Molecular formula | C10H8O4 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 4-oxo-2,3-dihydrochromene-8-carboxylic acid |
| InChIKey | XWMBBUVUBABHDZ-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1=O)C=CC=C2C(=O)O |
Computed by PubChem (NCBI)