CAS 91099-24-0 is the registry number for 7-Methoxy-1,2-dihydroquinazolin-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
7-methoxy-1H-quinazolin-2-one (CAS 91099-24-0) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 7-methoxy-1H-quinazolin-2-one. InChIKey: LYZUHKSZLAMHPX-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 7-methoxy-1H-quinazolin-2-one |
| InChIKey | LYZUHKSZLAMHPX-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C=NC(=O)N2 |
Computed by PubChem (NCBI)