Products 911388-96-0
CAS 911388-96-0 is the registry number for 6-Methyl-4-oxo-1,4-dihydro-1,5-naphthyridine-3-carbonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-methyl-4-oxo-1H-1,5-naphthyridine-3-carbonitrile (CAS 911388-96-0) is a chemical compound with the molecular formula C10H7N3O and a molecular weight of 185.18 g/mol. IUPAC name: 6-methyl-4-oxo-1H-1,5-naphthyridine-3-carbonitrile. InChIKey: CQFGDEVOZGHSPR-UHFFFAOYSA-N.
| Molecular formula | C10H7N3O |
|---|---|
| Molecular weight | 185.18 g/mol |
| IUPAC name | 6-methyl-4-oxo-1H-1,5-naphthyridine-3-carbonitrile |
| InChIKey | CQFGDEVOZGHSPR-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)NC=C(C2=O)C#N |
Computed by PubChem (NCBI)