CAS 91192-27-7 appears in our catalog under these names: Dabigatran Impurity 39, 2-((3-Cyanophenyl)amino)acetic acid, 98%, 2-((3-Cyanophenyl)amino)acetic acid, 2-[(3-cyanophenyl)amino]acetic acid, 98%, 98%, Dabigatran impurity 10, 99.86%. Offered by: Chemat Brand, AmBeed, Biosynth, Chemat, MedChemExpress. Available pack sizes: on request, 100mg, 1g, 250mg, 250 mg, 500 mg, 100 mg, 1 g.
2-(3-cyanoanilino)acetic acid (CAS 91192-27-7) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 2-(3-cyanoanilino)acetic acid. InChIKey: ZXEFJAWHZVPDKS-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 2-(3-cyanoanilino)acetic acid |
| InChIKey | ZXEFJAWHZVPDKS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NCC(=O)O)C#N |
Computed by PubChem (NCBI)