CAS 914933-75-8 appears in our catalog under these names: 3-Chloro-2,4-dimethoxybenzoic acid, 95%, 3-Chloro-2,4-dimethoxybenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-chloro-2,4-dimethoxybenzoic acid (CAS 914933-75-8) is a chemical compound with the molecular formula C9H9ClO4 and a molecular weight of 216.62 g/mol. IUPAC name: 3-chloro-2,4-dimethoxybenzoic acid. InChIKey: CRTJISYFGAVVBI-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO4 |
|---|---|
| Molecular weight | 216.62 g/mol |
| IUPAC name | 3-chloro-2,4-dimethoxybenzoic acid |
| InChIKey | CRTJISYFGAVVBI-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C(=O)O)OC)Cl |
Computed by PubChem (NCBI)