CAS 915070-97-2 appears in our catalog under these names: α,2-Difluorobenzeneacetic acid, 97%, 97%, 2-Fluoro-2-(2-fluorophenyl)acetic acid, 2-Fluoro-2-(2-fluorophenyl)acetic acid, 95%, 2-Fluoro-2-(2-fluorophenyl)acetic acid, 97%. Offered by: Chemat, Biosynth, AmBeed, Fluorochem. Available pack sizes: 50mg, 25mg, 1g, 100mg, 250mg, 500mg.
2-fluoro-2-(2-fluorophenyl)acetic acid (CAS 915070-97-2) is a chemical compound with the molecular formula C8H6F2O2 and a molecular weight of 172.13 g/mol. IUPAC name: 2-fluoro-2-(2-fluorophenyl)acetic acid. InChIKey: YXKCMBBVFIKJEG-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O2 |
|---|---|
| Molecular weight | 172.13 g/mol |
| IUPAC name | 2-fluoro-2-(2-fluorophenyl)acetic acid |
| InChIKey | YXKCMBBVFIKJEG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(=O)O)F)F |
Computed by PubChem (NCBI)