CAS 915920-73-9 is the registry number for 4-Bromo-3-formylphenyl acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(4-bromo-3-formylphenyl) acetate (CAS 915920-73-9) is a chemical compound with the molecular formula C9H7BrO3 and a molecular weight of 243.05 g/mol. IUPAC name: (4-bromo-3-formylphenyl) acetate. InChIKey: KVGIUGCXIJKTGO-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO3 |
|---|---|
| Molecular weight | 243.05 g/mol |
| IUPAC name | (4-bromo-3-formylphenyl) acetate |
| InChIKey | KVGIUGCXIJKTGO-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC(=C(C=C1)Br)C=O |
Computed by PubChem (NCBI)