Products 916420-62-7
CAS 916420-62-7 appears in our catalog under these names: 3,6-Dichloro-2-fluorobenzoic acid, 97%, 3,6-Dichloro-2-fluorobenzoic acid, 95+%, 3,6-Dichloro-2-fluorobenzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 25g, 5g, 10g.
3,6-dichloro-2-fluorobenzoic acid (CAS 916420-62-7) is a chemical compound with the molecular formula C7H3Cl2FO2 and a molecular weight of 209.00 g/mol. IUPAC name: 3,6-dichloro-2-fluorobenzoic acid. InChIKey: GPDYPRHGLQZRIP-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO2 |
|---|---|
| Molecular weight | 209.00 g/mol |
| IUPAC name | 3,6-dichloro-2-fluorobenzoic acid |
| InChIKey | GPDYPRHGLQZRIP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Cl)C(=O)O)F)Cl |
Computed by PubChem (NCBI)