Products 665022-07-1

CAS 665022-07-1 appears in our catalog under these names: 3,5-Dichloro-2-fluorobenzoic acid, 95%, 3,5-Dichloro-2-fluorobenzoic Acid, 3,5-Dichloro-2-fluorobenzoic Acid 95%, 3,5-dichloro-2-fluorobenzoic acid, 95%, 95%. Offered by: Combi-blocks, TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

3,5-dichloro-2-fluorobenzoic acid (CAS 665022-07-1) is a chemical compound with the molecular formula C7H3Cl2FO2 and a molecular weight of 209.00 g/mol. IUPAC name: 3,5-dichloro-2-fluorobenzoic acid. InChIKey: ONFMZPUMZYDTSL-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3Cl2FO2
Molecular weight209.00 g/mol
IUPAC name3,5-dichloro-2-fluorobenzoic acid
InChIKeyONFMZPUMZYDTSL-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1C(=O)O)F)Cl)Cl

Computed by PubChem (NCBI)