Products 1349715-68-9
CAS 1349715-68-9 appears in our catalog under these names: 3,4-Dichloro-2-fluorobenzoic acid, 95%, 3,4-Dichloro-2-fluorobenzoic acid, 3,4-Dichloro-2-fluorobenzoic acid 97%, 3,4-Dichloro-2-fluorobenzoic acid, ≥95%, ≥95%, 3,4-Dichloro-2-fluorobenzoic acid, ≥95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 50mg, 0,5g, 250mg, 1g, 5g.
3,4-dichloro-2-fluorobenzoic acid (CAS 1349715-68-9) is a chemical compound with the molecular formula C7H3Cl2FO2 and a molecular weight of 209.00 g/mol. IUPAC name: 3,4-dichloro-2-fluorobenzoic acid. InChIKey: HLDZSXDWETXHLY-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO2 |
|---|---|
| Molecular weight | 209.00 g/mol |
| IUPAC name | 3,4-dichloro-2-fluorobenzoic acid |
| InChIKey | HLDZSXDWETXHLY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)F)Cl)Cl |
Computed by PubChem (NCBI)