CAS 98191-30-1 appears in our catalog under these names: 3,5-Dichloro-4-fluorobenzoic acid, 3,5-Dichloro-4-fluorobenzoic acid 98%, 3,5-Dichloro-4-fluorobenzoic acid, 98%, 98%, 3,5-Dichloro-4-fluorobenzoic acid, 95%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 50g, 1g, 5g, 25g, 500g.
3,5-dichloro-4-fluorobenzoic acid (CAS 98191-30-1) is a chemical compound with the molecular formula C7H3Cl2FO2 and a molecular weight of 209.00 g/mol. IUPAC name: 3,5-dichloro-4-fluorobenzoic acid. InChIKey: CRRHVMZOOBWYRG-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO2 |
|---|---|
| Molecular weight | 209.00 g/mol |
| IUPAC name | 3,5-dichloro-4-fluorobenzoic acid |
| InChIKey | CRRHVMZOOBWYRG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)F)Cl)C(=O)O |
Computed by PubChem (NCBI)