Products 904285-09-2

CAS 904285-09-2 appears in our catalog under these names: 2,4-Dichloro-6-fluorobenzoic acid, 95%, 2,4–Dichloro–6–fluorobenzoic acid, 2,4-Dichloro-6-fluorobenzoic acid 95%, 2,4-Dichloro-6-fluorobenzoic acid, 98%, 98%, 2,4-Dichloro-6-fluorobenzoic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2,4-dichloro-6-fluorobenzoic acid (CAS 904285-09-2) is a chemical compound with the molecular formula C7H3Cl2FO2 and a molecular weight of 209.00 g/mol. IUPAC name: 2,4-dichloro-6-fluorobenzoic acid. InChIKey: RGGDLWPZNITCMJ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3Cl2FO2
Molecular weight209.00 g/mol
IUPAC name2,4-dichloro-6-fluorobenzoic acid
InChIKeyRGGDLWPZNITCMJ-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1F)C(=O)O)Cl)Cl

Computed by PubChem (NCBI)