CAS 904285-09-2 appears in our catalog under these names: 2,4-Dichloro-6-fluorobenzoic acid, 95%, 2,4–Dichloro–6–fluorobenzoic acid, 2,4-Dichloro-6-fluorobenzoic acid 95%, 2,4-Dichloro-6-fluorobenzoic acid, 98%, 98%, 2,4-Dichloro-6-fluorobenzoic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg, 100mg.
2,4-dichloro-6-fluorobenzoic acid (CAS 904285-09-2) is a chemical compound with the molecular formula C7H3Cl2FO2 and a molecular weight of 209.00 g/mol. IUPAC name: 2,4-dichloro-6-fluorobenzoic acid. InChIKey: RGGDLWPZNITCMJ-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO2 |
|---|---|
| Molecular weight | 209.00 g/mol |
| IUPAC name | 2,4-dichloro-6-fluorobenzoic acid |
| InChIKey | RGGDLWPZNITCMJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)