CAS 32890-91-8 appears in our catalog under these names: 2,3-Dichloro-6-fluorobenzoic acid, 95%, 2,3-Dichloro-6-fluorobenzoic acid 98+%, 2,3-Dichloro-6-fluorobenzoic acid, 98+%, 98+%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 10g.
2,3-dichloro-6-fluorobenzoic acid (CAS 32890-91-8) is a chemical compound with the molecular formula C7H3Cl2FO2 and a molecular weight of 209.00 g/mol. IUPAC name: 2,3-dichloro-6-fluorobenzoic acid. InChIKey: OOQKLNYJVMPYIF-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO2 |
|---|---|
| Molecular weight | 209.00 g/mol |
| IUPAC name | 2,3-dichloro-6-fluorobenzoic acid |
| InChIKey | OOQKLNYJVMPYIF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)