Products 178813-78-0

CAS 178813-78-0 appears in our catalog under these names: 2,6–Dichloro–3–fluorobenzoic acid, 2,6-Dichloro-3-fluorobenzoic acid 98%, 2,6-Dichloro-3-fluorobenzoic acid, 98%, 98%, 2,6-Dichloro-3-fluorobenzoic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 1g, 25g, 5g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

2,6-dichloro-3-fluorobenzoic acid (CAS 178813-78-0) is a chemical compound with the molecular formula C7H3Cl2FO2 and a molecular weight of 209.00 g/mol. IUPAC name: 2,6-dichloro-3-fluorobenzoic acid. InChIKey: NMFMJSSFYLXQAO-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3Cl2FO2
Molecular weight209.00 g/mol
IUPAC name2,6-dichloro-3-fluorobenzoic acid
InChIKeyNMFMJSSFYLXQAO-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1F)Cl)C(=O)O)Cl

Computed by PubChem (NCBI)