CAS 289039-49-2 appears in our catalog under these names: 4,5-Dichloro-2-fluorobenzoic acid 95%, 4,5-Dichloro-2-fluorobenzoic acid, 98%, 4,5-Dichloro-2-fluorobenzoic acid, 98%, 98%. Offered by: Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 25g, 10g, 100g, 250mg.
4,5-dichloro-2-fluorobenzoic acid (CAS 289039-49-2) is a chemical compound with the molecular formula C7H3Cl2FO2 and a molecular weight of 209.00 g/mol. IUPAC name: 4,5-dichloro-2-fluorobenzoic acid. InChIKey: XFOJZPTYJMXNKK-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO2 |
|---|---|
| Molecular weight | 209.00 g/mol |
| IUPAC name | 4,5-dichloro-2-fluorobenzoic acid |
| InChIKey | XFOJZPTYJMXNKK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)F)C(=O)O |
Computed by PubChem (NCBI)