Products 916651-12-2
CAS 916651-12-2 is the registry number for 4,4''-Dimethoxy-[1,1':4',1''-terphenyl]-2',5'-dicarbaldehyde, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,5-bis(4-methoxyphenyl)terephthalaldehyde (CAS 916651-12-2) is a chemical compound with the molecular formula C22H18O4 and a molecular weight of 346.4 g/mol. IUPAC name: 2,5-bis(4-methoxyphenyl)terephthalaldehyde. InChIKey: UJBSOOWGSHYHOR-UHFFFAOYSA-N.
| Molecular formula | C22H18O4 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | 2,5-bis(4-methoxyphenyl)terephthalaldehyde |
| InChIKey | UJBSOOWGSHYHOR-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC(=C(C=C2C=O)C3=CC=C(C=C3)OC)C=O |
Computed by PubChem (NCBI)