Products 91843-18-4
CAS 91843-18-4 appears in our catalog under these names: 4-(3-Aminophenyl)butanoic acid hydrochloride 95%, 4-(3-Aminophenyl)butanoic acid hydrochloride, 96%, 4-(3-Aminophenyl)butanoic acid hydrochloride, 95%, 95%. Offered by: Ambeed, Fluorochem, Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g.
4-(3-aminophenyl)butanoic acid;hydrochloride (CAS 91843-18-4) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: 4-(3-aminophenyl)butanoic acid;hydrochloride. InChIKey: KQDRRBHCFUEQIW-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | 4-(3-aminophenyl)butanoic acid;hydrochloride |
| InChIKey | KQDRRBHCFUEQIW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)CCCC(=O)O.Cl |
Computed by PubChem (NCBI)
Synonyms:
4-(3-aminophenyl)butanoic Acid Hydrochloride, 4-(3-Aminophenyl)butyric Acid, Hydrochloride, 4-(3-aminophenyl)butanoic acid;hydrochloride, 4-(3-AMINOPHENYL)BUTYRIC ACID,hydrochloride, 4-(3-Aminophenyl)butanoic acid HCl, 3-Amino-benzenebutanoic Acid Hydrochloride;, Benzenebutanoic a, Benzenebutanoic acid, 3-amino-, hydrochloride, 4-(3-Aminophenyl)butyric Acid HCl, 4-(3-Aminophenyl)butanoic acid--hydrogen chloride (1/1)