Products 92013-04-2
CAS 92013-04-2 is the registry number for 1-(1-acetylindol-6-yl)-2-chloroethanone, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
1-(1-acetylindol-6-yl)-2-chloroethanone (CAS 92013-04-2) is a chemical compound with the molecular formula C12H10ClNO2 and a molecular weight of 235.66 g/mol. IUPAC name: 1-(1-acetylindol-6-yl)-2-chloroethanone. InChIKey: BYHLFTIPLYCPAW-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO2 |
|---|---|
| Molecular weight | 235.66 g/mol |
| IUPAC name | 1-(1-acetylindol-6-yl)-2-chloroethanone |
| InChIKey | BYHLFTIPLYCPAW-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C=CC2=C1C=C(C=C2)C(=O)CCl |
Computed by PubChem (NCBI)