CAS 92152-08-4 appears in our catalog under these names: 1,6-Di(furan-2-yl)hexa-1,5-diene-3,4-dione, 98%, 98%, 1,6-Di(furan-2-yl)hexa-1,5-diene-3,4-dione, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
(1E,5E)-1,6-bis(furan-2-yl)hexa-1,5-diene-3,4-dione (CAS 92152-08-4) is a chemical compound with the molecular formula C14H10O4 and a molecular weight of 242.23 g/mol. IUPAC name: (1E,5E)-1,6-bis(furan-2-yl)hexa-1,5-diene-3,4-dione. InChIKey: NUOLJIJNXPXAID-KQQUZDAGSA-N.
| Molecular formula | C14H10O4 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | (1E,5E)-1,6-bis(furan-2-yl)hexa-1,5-diene-3,4-dione |
| InChIKey | NUOLJIJNXPXAID-KQQUZDAGSA-N |
| SMILES | C1=COC(=C1)/C=C/C(=O)C(=O)/C=C/C2=CC=CO2 |
Computed by PubChem (NCBI)