CAS 92254-23-4 appears in our catalog under these names: Ethanone, 2-hydroxy-1-(4-phenoxyphenyl)-, 98%, 2-Hydroxy-1-(4-phenoxyphenyl)ethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-hydroxy-1-(4-phenoxyphenyl)ethanone (CAS 92254-23-4) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 228.24 g/mol. IUPAC name: 2-hydroxy-1-(4-phenoxyphenyl)ethanone. InChIKey: IOSCPIQFGPNXOA-UHFFFAOYSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | 2-hydroxy-1-(4-phenoxyphenyl)ethanone |
| InChIKey | IOSCPIQFGPNXOA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)C(=O)CO |
Computed by PubChem (NCBI)