Products 92286-62-9
CAS 92286-62-9 appears in our catalog under these names: 3-(4-Hydroxyphenyl)-5-methylisoxazole-4-carboxylic acid, 95%, 3–(4–Hydroxyphenyl)–5–methylisoxazole–4–carboxylic Acid, 3-(4-Hydroxyphenyl)-5-methylisoxazole-4-carboxylic Acid, >97%, >97%, 3-(4-HYDROXYPHENYL)-5-METHYLISOXAZOLE-4-CARBOXYLIC ACID, >97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
3-(4-hydroxyphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid (CAS 92286-62-9) is a chemical compound with the molecular formula C11H9NO4 and a molecular weight of 219.19 g/mol. IUPAC name: 3-(4-hydroxyphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid. InChIKey: BTTLFVOOKINLNL-UHFFFAOYSA-N.
| Molecular formula | C11H9NO4 |
|---|---|
| Molecular weight | 219.19 g/mol |
| IUPAC name | 3-(4-hydroxyphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid |
| InChIKey | BTTLFVOOKINLNL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=C(C=C2)O)C(=O)O |
Computed by PubChem (NCBI)