Products 923156-14-3
CAS 923156-14-3 is the registry number for 4-(2-Chloroacetyl)-3,4-dihydro-2h-1,4-benzoxazine-2-carboxamide, 98%, 98%. Offered by: Chemat. Available pack sizes: 50mg, 250mg.
4-(2-chloroacetyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide (CAS 923156-14-3) is a chemical compound with the molecular formula C11H11ClN2O3 and a molecular weight of 254.67 g/mol. IUPAC name: 4-(2-chloroacetyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide. InChIKey: ARXMOGIPJRHYNG-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2O3 |
|---|---|
| Molecular weight | 254.67 g/mol |
| IUPAC name | 4-(2-chloroacetyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| InChIKey | ARXMOGIPJRHYNG-UHFFFAOYSA-N |
| SMILES | C1C(OC2=CC=CC=C2N1C(=O)CCl)C(=O)N |
Computed by PubChem (NCBI)