Products 923163-52-4

CAS 923163-52-4 is the registry number for 2-{(2-(4-Chlorophenoxy)ethyl)sulfanyl}acetic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

2-[2-(4-chlorophenoxy)ethylsulfanyl]acetic acid (CAS 923163-52-4) is a chemical compound with the molecular formula C10H11ClO3S and a molecular weight of 246.71 g/mol. IUPAC name: 2-[2-(4-chlorophenoxy)ethylsulfanyl]acetic acid. InChIKey: SENQEYBTQCBZDQ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11ClO3S
Molecular weight246.71 g/mol
IUPAC name2-[2-(4-chlorophenoxy)ethylsulfanyl]acetic acid
InChIKeySENQEYBTQCBZDQ-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1OCCSCC(=O)O)Cl

Computed by PubChem (NCBI)