CAS 923238-81-7 appears in our catalog under these names: 1H,2H,3H-Naphtho(2,1-b)pyran-2-carboxylic acid, 95%, 1H,2H,3H-Naphtho(2,1-b)pyran-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2,3-dihydro-1H-benzo[f]chromene-2-carboxylic acid (CAS 923238-81-7) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 228.24 g/mol. IUPAC name: 2,3-dihydro-1H-benzo[f]chromene-2-carboxylic acid. InChIKey: WOGFRQYQWSZVJK-UHFFFAOYSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | 2,3-dihydro-1H-benzo[f]chromene-2-carboxylic acid |
| InChIKey | WOGFRQYQWSZVJK-UHFFFAOYSA-N |
| SMILES | C1C(COC2=C1C3=CC=CC=C3C=C2)C(=O)O |
Computed by PubChem (NCBI)