Products 926254-39-9
CAS 926254-39-9 is the registry number for Methyl 2-amino-5-(thiophen-2-yl)benzoate. Offered by: Biosynth. Available pack sizes: 100mg.
Methyl 2-amino-5-thiophen-2-ylbenzoate (CAS 926254-39-9) is a chemical compound with the molecular formula C12H11NO2S and a molecular weight of 233.29 g/mol. IUPAC name: methyl 2-amino-5-thiophen-2-ylbenzoate. InChIKey: PNNRKISKHNTAHL-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2S |
|---|---|
| Molecular weight | 233.29 g/mol |
| IUPAC name | methyl 2-amino-5-thiophen-2-ylbenzoate |
| InChIKey | PNNRKISKHNTAHL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)C2=CC=CS2)N |
Computed by PubChem (NCBI)