Products 927676-33-3
CAS 927676-33-3 appears in our catalog under these names: 2-Hydroxy-[1,1'-biphenyl]-4,4'-dicarboxylic acid, 98%, 2-Hydroxy-[1,1'-biphenyl]-4,4'-dicarboxylic acid, 97%. Offered by: Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-(4-carboxyphenyl)-3-hydroxybenzoic acid (CAS 927676-33-3) is a chemical compound with the molecular formula C14H10O5 and a molecular weight of 258.23 g/mol. IUPAC name: 4-(4-carboxyphenyl)-3-hydroxybenzoic acid. InChIKey: UCBTVMWOHPIRJE-UHFFFAOYSA-N.
| Molecular formula | C14H10O5 |
|---|---|
| Molecular weight | 258.23 g/mol |
| IUPAC name | 4-(4-carboxyphenyl)-3-hydroxybenzoic acid |
| InChIKey | UCBTVMWOHPIRJE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=C(C=C2)C(=O)O)O)C(=O)O |
Computed by PubChem (NCBI)