Products 927800-88-2
CAS 927800-88-2 is the registry number for 2-(4-Fluorophenyl)-1,3-oxazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(4-fluorophenyl)-1,3-oxazole-4-carboxylic acid (CAS 927800-88-2) is a chemical compound with the molecular formula C10H6FNO3 and a molecular weight of 207.16 g/mol. IUPAC name: 2-(4-fluorophenyl)-1,3-oxazole-4-carboxylic acid. InChIKey: MSCLIRZXOMOBOM-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO3 |
|---|---|
| Molecular weight | 207.16 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-1,3-oxazole-4-carboxylic acid |
| InChIKey | MSCLIRZXOMOBOM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=CO2)C(=O)O)F |
Computed by PubChem (NCBI)