CAS 928714-37-8 appears in our catalog under these names: Methyl 3-acetylisonicotinate, 98%, Methyl 3-acetylisonicotinate, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 100mg, 250mg, 1g.
Methyl 3-acetylpyridine-4-carboxylate (CAS 928714-37-8) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: methyl 3-acetylpyridine-4-carboxylate. InChIKey: RXFYQTCTGSWZKO-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | methyl 3-acetylpyridine-4-carboxylate |
| InChIKey | RXFYQTCTGSWZKO-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CN=C1)C(=O)OC |
Computed by PubChem (NCBI)