CAS 92906-36-0 is the registry number for 7-Hydroxy-4-(4-pyridyl)coumarin, 95%. Offered by: Fluorochem. Available pack sizes: 1g, 5g, 25g.
7-hydroxy-4-pyridin-4-ylchromen-2-one (CAS 92906-36-0) is a chemical compound with the molecular formula C14H9NO3 and a molecular weight of 239.23 g/mol. IUPAC name: 7-hydroxy-4-pyridin-4-ylchromen-2-one. InChIKey: PTBKPYBPJZBSMP-UHFFFAOYSA-N.
| Molecular formula | C14H9NO3 |
|---|---|
| Molecular weight | 239.23 g/mol |
| IUPAC name | 7-hydroxy-4-pyridin-4-ylchromen-2-one |
| InChIKey | PTBKPYBPJZBSMP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)OC(=O)C=C2C3=CC=NC=C3 |
Computed by PubChem (NCBI)