Products 929206-20-2
CAS 929206-20-2 is the registry number for Malathion Impurity 6. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
4-O-tert-butyl 1-O-ethyl (Z)-but-2-enedioate (CAS 929206-20-2) is a chemical compound with the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. IUPAC name: 4-O-tert-butyl 1-O-ethyl (Z)-but-2-enedioate. InChIKey: CZFQVAZEWFKUTC-SREVYHEPSA-N.
| Molecular formula | C10H16O4 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | 4-O-tert-butyl 1-O-ethyl (Z)-but-2-enedioate |
| InChIKey | CZFQVAZEWFKUTC-SREVYHEPSA-N |
| SMILES | CCOC(=O)/C=C\C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)