Products 932373-91-6
CAS 932373-91-6 appears in our catalog under these names: 2-(3,5-Difluoro-4-nitrophenyl)acetic acid, 97%, 97%, 2-(3,5-Difluoro-4-nitrophenyl)acetic acid, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-(3,5-difluoro-4-nitrophenyl)acetic acid (CAS 932373-91-6) is a chemical compound with the molecular formula C8H5F2NO4 and a molecular weight of 217.13 g/mol. IUPAC name: 2-(3,5-difluoro-4-nitrophenyl)acetic acid. InChIKey: XGLFBUVWWKDQKP-UHFFFAOYSA-N.
| Molecular formula | C8H5F2NO4 |
|---|---|
| Molecular weight | 217.13 g/mol |
| IUPAC name | 2-(3,5-difluoro-4-nitrophenyl)acetic acid |
| InChIKey | XGLFBUVWWKDQKP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)[N+](=O)[O-])F)CC(=O)O |
Computed by PubChem (NCBI)