CAS 932801-86-0 appears in our catalog under these names: 5-(Phenoxymethyl)-1,2-oxazole-3-carboxylic acid, 95%, 5-(Phenoxymethyl)-1,2-oxazole-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
5-(phenoxymethyl)-1,2-oxazole-3-carboxylic acid (CAS 932801-86-0) is a chemical compound with the molecular formula C11H9NO4 and a molecular weight of 219.19 g/mol. IUPAC name: 5-(phenoxymethyl)-1,2-oxazole-3-carboxylic acid. InChIKey: SQQNUTPYPNFZLM-UHFFFAOYSA-N.
| Molecular formula | C11H9NO4 |
|---|---|
| Molecular weight | 219.19 g/mol |
| IUPAC name | 5-(phenoxymethyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | SQQNUTPYPNFZLM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OCC2=CC(=NO2)C(=O)O |
Computed by PubChem (NCBI)