Products 932975-98-9

CAS 932975-98-9 is the registry number for 3-(4-Benzyl-2,3-dioxopiperazin-1-yl)propanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(4-benzyl-2,3-dioxopiperazin-1-yl)propanoic acid (CAS 932975-98-9) is a chemical compound with the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. IUPAC name: 3-(4-benzyl-2,3-dioxopiperazin-1-yl)propanoic acid. InChIKey: YDXOWWITCWZBPL-UHFFFAOYSA-N.

Identity
Molecular formulaC14H16N2O4
Molecular weight276.29 g/mol
IUPAC name3-(4-benzyl-2,3-dioxopiperazin-1-yl)propanoic acid
InChIKeyYDXOWWITCWZBPL-UHFFFAOYSA-N
SMILESC1CN(C(=O)C(=O)N1CCC(=O)O)CC2=CC=CC=C2

Computed by PubChem (NCBI)