Products 933752-23-9
CAS 933752-23-9 appears in our catalog under these names: 1-Oxoisochromane-6-carboxylic acid, 97%, 97%, 1-Oxoisochroman-6-carboxylic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-oxo-3,4-dihydroisochromene-6-carboxylic acid (CAS 933752-23-9) is a chemical compound with the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. IUPAC name: 1-oxo-3,4-dihydroisochromene-6-carboxylic acid. InChIKey: FYUMUSXUORKUTC-UHFFFAOYSA-N.
| Molecular formula | C10H8O4 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 1-oxo-3,4-dihydroisochromene-6-carboxylic acid |
| InChIKey | FYUMUSXUORKUTC-UHFFFAOYSA-N |
| SMILES | C1COC(=O)C2=C1C=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
1-Oxoisochromane-6-carboxylic acid