CAS 934016-09-8 appears in our catalog under these names: Methyl 4-acetylpicolinate, 95%, Methyl 4-acetylpicolinate 97%, Methyl 4-acetylpyridine-2-carboxylate, 97%, 97%, Methyl 4-acetylpicolinate, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g.
Methyl 4-acetylpyridine-2-carboxylate (CAS 934016-09-8) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: methyl 4-acetylpyridine-2-carboxylate. InChIKey: GZLDGDOOYSWNMY-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | methyl 4-acetylpyridine-2-carboxylate |
| InChIKey | GZLDGDOOYSWNMY-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=NC=C1)C(=O)OC |
Computed by PubChem (NCBI)