CAS 934524-28-4 is the registry number for 4-amino-N-(2,2,2-trifluoroethyl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-amino-N-(2,2,2-trifluoroethyl)benzamide (CAS 934524-28-4) is a chemical compound with the molecular formula C9H9F3N2O and a molecular weight of 218.18 g/mol. IUPAC name: 4-amino-N-(2,2,2-trifluoroethyl)benzamide. InChIKey: JJSRGTLQYXZSQR-UHFFFAOYSA-N.
| Molecular formula | C9H9F3N2O |
|---|---|
| Molecular weight | 218.18 g/mol |
| IUPAC name | 4-amino-N-(2,2,2-trifluoroethyl)benzamide |
| InChIKey | JJSRGTLQYXZSQR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NCC(F)(F)F)N |
Computed by PubChem (NCBI)