CAS 935843-18-8 is the registry number for 4-Chloro-2,5-dimethylthieno(2,3-d)pyrimidine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-chloro-2,5-dimethylthieno[2,3-d]pyrimidine (CAS 935843-18-8) is a chemical compound with the molecular formula C8H7ClN2S and a molecular weight of 198.67 g/mol. IUPAC name: 4-chloro-2,5-dimethylthieno[2,3-d]pyrimidine. InChIKey: JYVYSSMMLABHII-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2S |
|---|---|
| Molecular weight | 198.67 g/mol |
| IUPAC name | 4-chloro-2,5-dimethylthieno[2,3-d]pyrimidine |
| InChIKey | JYVYSSMMLABHII-UHFFFAOYSA-N |
| SMILES | CC1=CSC2=C1C(=NC(=N2)C)Cl |
Computed by PubChem (NCBI)