Products 936728-00-6
CAS 936728-00-6 appears in our catalog under these names: 1–(Quinolin–6–yl)cyclopropanecarboxylic acid, 1-(Quinolin-6-yl)cyclopropanecarboxylic acid, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
1-quinolin-6-ylcyclopropane-1-carboxylic acid (CAS 936728-00-6) is a chemical compound with the molecular formula C13H11NO2 and a molecular weight of 213.23 g/mol. IUPAC name: 1-quinolin-6-ylcyclopropane-1-carboxylic acid. InChIKey: WGIHHDCKQNSCIX-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | 1-quinolin-6-ylcyclopropane-1-carboxylic acid |
| InChIKey | WGIHHDCKQNSCIX-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC3=C(C=C2)N=CC=C3)C(=O)O |
Computed by PubChem (NCBI)