CAS 938-71-6 appears in our catalog under these names: 4-Chloro-2-nitrobenzyl chloride, 98%, 4-Chloro-2-nitrobenzyl chloride. Offered by: Combi-blocks, Biosynth, Thermo Scientific (Acros). Available pack sizes: 1g, 25g, 10g, 5g.
4-chloro-1-(chloromethyl)-2-nitrobenzene (CAS 938-71-6) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: 4-chloro-1-(chloromethyl)-2-nitrobenzene. InChIKey: OMPHLGROCARZOU-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO2 |
|---|---|
| Molecular weight | 206.02 g/mol |
| IUPAC name | 4-chloro-1-(chloromethyl)-2-nitrobenzene |
| InChIKey | OMPHLGROCARZOU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)[N+](=O)[O-])CCl |
Computed by PubChem (NCBI)