Products 93887-31-1
CAS 93887-31-1 is the registry number for 2-Oxo-3,4-dihydro-2H-1-benzopyran-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-oxo-3,4-dihydrochromene-3-carboxylic acid (CAS 93887-31-1) is a chemical compound with the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. IUPAC name: 2-oxo-3,4-dihydrochromene-3-carboxylic acid. InChIKey: MBUFGQWXDBCBSX-UHFFFAOYSA-N.
| Molecular formula | C10H8O4 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 2-oxo-3,4-dihydrochromene-3-carboxylic acid |
| InChIKey | MBUFGQWXDBCBSX-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)OC2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)