Products 93952-05-7
CAS 93952-05-7 appears in our catalog under these names: Diphenyl-d10 Ether, 98 atom % D, min 98% Chemical Purity, Diphenyl ether-d10. Offered by: CDN, MedChemExpress. Available pack sizes: 1g, 0,5g, 25 mg, 100 mg, 50 mg.
1,2,3,4,5-pentadeuterio-6-(2,3,4,5,6-pentadeuteriophenoxy)benzene (CAS 93952-05-7) is a chemical compound with the molecular formula C12H10O and a molecular weight of 180.27 g/mol. IUPAC name: 1,2,3,4,5-pentadeuterio-6-(2,3,4,5,6-pentadeuteriophenoxy)benzene. InChIKey: USIUVYZYUHIAEV-LHNTUAQVSA-N.
| Molecular formula | C12H10O |
|---|---|
| Molecular weight | 180.27 g/mol |
| IUPAC name | 1,2,3,4,5-pentadeuterio-6-(2,3,4,5,6-pentadeuteriophenoxy)benzene |
| InChIKey | USIUVYZYUHIAEV-LHNTUAQVSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])OC2=C(C(=C(C(=C2[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)