Products 940088-41-5

CAS 940088-41-5 is the registry number for 2-(3-({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)propoxy)acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propoxy]acetic acid (CAS 940088-41-5) is a chemical compound with the molecular formula C20H21NO5 and a molecular weight of 355.4 g/mol. IUPAC name: 2-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propoxy]acetic acid. InChIKey: UOOYSCRVCQJNAS-UHFFFAOYSA-N.

Identity
Molecular formulaC20H21NO5
Molecular weight355.4 g/mol
IUPAC name2-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propoxy]acetic acid
InChIKeyUOOYSCRVCQJNAS-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCCOCC(=O)O

Computed by PubChem (NCBI)