CAS 942493-22-3 appears in our catalog under these names: 6-Methoxy-7-methylindoline-2,3-dione, 95+%, 6-Methoxy-7-methylindoline-2,3-dione, 98%, 98%, 6-Methoxy-7-methylindoline-2,3-dione, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
6-methoxy-7-methyl-1H-indole-2,3-dione (CAS 942493-22-3) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 6-methoxy-7-methyl-1H-indole-2,3-dione. InChIKey: MLAKMNXYCQXOPO-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 6-methoxy-7-methyl-1H-indole-2,3-dione |
| InChIKey | MLAKMNXYCQXOPO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1NC(=O)C2=O)OC |
Computed by PubChem (NCBI)