CAS 943894-85-7 appears in our catalog under these names: 6-(Aminomethyl)-3-methyl-2,3-dihydro-1,3-benzoxazol-2-one, 95%, 6-(Aminomethyl)-3-methyl-2,3-dihydro-1,3-benzoxazol-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
6-(aminomethyl)-3-methyl-1,3-benzoxazol-2-one (CAS 943894-85-7) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: 6-(aminomethyl)-3-methyl-1,3-benzoxazol-2-one. InChIKey: XNYQTDQCTDELDM-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | 6-(aminomethyl)-3-methyl-1,3-benzoxazol-2-one |
| InChIKey | XNYQTDQCTDELDM-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)CN)OC1=O |
Computed by PubChem (NCBI)