CAS 944898-55-9 is the registry number for 6-Methoxy-2-benzoxazolecarboxylic Acid. Offered by: TRC. Available pack sizes: 500mg.
6-methoxy-1,3-benzoxazole-2-carboxylic acid (CAS 944898-55-9) is a chemical compound with the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. IUPAC name: 6-methoxy-1,3-benzoxazole-2-carboxylic acid. InChIKey: VNXLFSQGIANKER-UHFFFAOYSA-N.
| Molecular formula | C9H7NO4 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 6-methoxy-1,3-benzoxazole-2-carboxylic acid |
| InChIKey | VNXLFSQGIANKER-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)N=C(O2)C(=O)O |
Computed by PubChem (NCBI)