Products 944906-88-1
CAS 944906-88-1 is the registry number for (5-(3-Bromophenyl)-1,3,4-oxadiazol-2-yl)methanamine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
[5-(3-bromophenyl)-1,3,4-oxadiazol-2-yl]methanamine (CAS 944906-88-1) is a chemical compound with the molecular formula C9H8BrN3O and a molecular weight of 254.08 g/mol. IUPAC name: [5-(3-bromophenyl)-1,3,4-oxadiazol-2-yl]methanamine. InChIKey: FMXBUUMIALSMFM-UHFFFAOYSA-N.
| Molecular formula | C9H8BrN3O |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | [5-(3-bromophenyl)-1,3,4-oxadiazol-2-yl]methanamine |
| InChIKey | FMXBUUMIALSMFM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2=NN=C(O2)CN |
Computed by PubChem (NCBI)