Products 947-62-6
CAS 947-62-6 appears in our catalog under these names: 2-Methoxy-1-naphthoic acid, 98%, 2–Methoxy–1–naphthoic Acid, 2-Methoxy-1-naphthoic Acid, 2-Methoxy-1-naphthoic Acid, >98.0%(GC)(T), 2-Methoxy-1-naphthoic acid 98%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 25g, 1g, 5g, 10g, 250mg, 100mg.
2-methoxynaphthalene-1-carboxylic acid (CAS 947-62-6) is a chemical compound with the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. IUPAC name: 2-methoxynaphthalene-1-carboxylic acid. InChIKey: OSTYZAHQVPMQHI-UHFFFAOYSA-N.
| Molecular formula | C12H10O3 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 2-methoxynaphthalene-1-carboxylic acid |
| InChIKey | OSTYZAHQVPMQHI-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=CC=CC=C2C=C1)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-Methoxy-1-naphthoic acid, 2-methoxy-1-naphthalenecarboxylic acid, 2-methoxynaphthalene-1-carboxylic acid, 2-Methoxy-1-naphthoic acid, 98%, 2-Methoxynaphthoic acid, 1-Naphthoic acid, 2-methoxy-, Methoxynaphthoesaure, 1-Naphthalenecarboxylic acid, 2-methoxy-, 2-Methoxy napthoic acid, 2-methoxy-1-naphtoic acid