Products 94740-43-9
CAS 94740-43-9 appears in our catalog under these names: L–Arginine–13C hydrochloride, L-Arginine-13C (hydrochloride), 99.7%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 10 mg, 50 mg, 5 mg, 25 mg.
(2S)-2-amino-5-(diamino(113C)methylideneamino)pentanoic acid;hydrochloride (CAS 94740-43-9) is a chemical compound with the molecular formula C6H15ClN4O2 and a molecular weight of 211.65 g/mol. IUPAC name: (2S)-2-amino-5-(diamino(113C)methylideneamino)pentanoic acid;hydrochloride. InChIKey: KWTQSFXGGICVPE-QHHRSMDYSA-N.
| Molecular formula | C6H15ClN4O2 |
|---|---|
| Molecular weight | 211.65 g/mol |
| IUPAC name | (2S)-2-amino-5-(diamino(113C)methylideneamino)pentanoic acid;hydrochloride |
| InChIKey | KWTQSFXGGICVPE-QHHRSMDYSA-N |
| SMILES | C(C[C@@H](C(=O)O)N)CN=[13C](N)N.Cl |
Computed by PubChem (NCBI)