CAS 947494-53-3 appears in our catalog under these names: Methyl 5-amino-2-cyanobenzoate, 95%, Methyl 5-amino-2-cyanobenzoate, Methyl 5-amino-2-cyanobenzoate 98%, Methyl 5-Amino-2-Cyanobenzoate, 95%, 95%, METHYL 5-AMINO-2-CYANOBENZOATE, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 0,5g, 100mg, 500mg, 10g.
Methyl 5-amino-2-cyanobenzoate (CAS 947494-53-3) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: methyl 5-amino-2-cyanobenzoate. InChIKey: GBJNJFHFMGGUBN-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | methyl 5-amino-2-cyanobenzoate |
| InChIKey | GBJNJFHFMGGUBN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)N)C#N |
Computed by PubChem (NCBI)